* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ISOPHTHALOYL-2,2'-13C2 CHLORIDE |
| CAS: | 286425-30-7 |
| EnglishSynonyms: | ISOPHTHALOYL-2,2'-13C2 CHLORIDE |
| pro_mdlNumber: | MFCD00083999 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | c1cc(cc(c1)[13C](=O)Cl)[13C](=O)Cl |
| InChi: | InChI=1S/C8H4Cl2O2/c9-7(11)5-2-1-3-6(4-5)8(10)12/h1-4H/i7+1,8+1 |
| InChiKey: | InChIKey=FDQSRULYDNDXQB-BFGUONQLSA-N |
|
|
| MeltingPoint: | 43-44 DEG C(LIT) |
| Comments: | MASS SHIFT: M+2 RIDADR: UN 3261 8/PG 2 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 204.99 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.