* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DL-VALINE-2-13C |
| EnglishSynonyms: | DL-VALINE-2-13C |
| pro_mdlNumber: | MFCD00084099 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC(C)[13CH](C(=O)O)N |
| InChi: | InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)/i4+1 |
| InChiKey: | InChIKey=KZSNJWFQEVHDMF-AZXPZELESA-N |
|
|
| MeltingPoint: | 295 DEG C (SUBL)(LIT) |
| Comments: | MASS SHIFT: M+1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 118.14 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.