* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL F1 4042 |
| EnglishSynonyms: | RARECHEM AL F1 4042 |
| pro_mdlNumber: | MFCD00102787 |
| pro_acceptors: | 12 |
| pro_donors: | 1 |
| pro_smile: | c1ccc(cc1)c2ccc(cc2)n3c(nnn3)C/C=N/Nc4ccc(cc4[N+](=O)[O-])[N+](=O)[O-] |
| InChi: | InChI=1S/C21H16N8O4/c30-28(31)18-10-11-19(20(14-18)29(32)33)23-22-13-12-21-24-25-26-27(21)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-11,13-14,23H,12H2/b22-13+ |
| InChiKey: | InChIKey=DSVPDGCKBDDOJF-LPYMAVHISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.