* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FC 0020 |
| EnglishSynonyms: | RARECHEM AL FC 0020 |
| pro_mdlNumber: | MFCD00102812 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | c1ccc(cc1)n2c(nnn2)/C=C/N3CCCCC3 |
| InChi: | InChI=1S/C14H17N5/c1-3-7-13(8-4-1)19-14(15-16-17-19)9-12-18-10-5-2-6-11-18/h1,3-4,7-9,12H,2,5-6,10-11H2/b12-9+ |
| InChiKey: | InChIKey=XBOVYKXOQWFXTR-FMIVXFBMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.