* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL F1 4011 |
EnglishSynonyms: | RARECHEM AL F1 4011 |
pro_mdlNumber: | MFCD00102827 |
pro_acceptors: | 5 |
pro_donors: | 0 |
pro_smile: | c1ccc(cc1)c2ccc(cc2)n3c(nnn3)/C=C/N4CCCCCC4 |
InChi: | InChI=1S/C21H23N5/c1-2-7-16-25(15-6-1)17-14-21-22-23-24-26(21)20-12-10-19(11-13-20)18-8-4-3-5-9-18/h3-5,8-14,17H,1-2,6-7,15-16H2/b17-14+ |
InChiKey: | InChIKey=YZULJWWBOANRNC-SAPNQHFASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.