* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FC 0007 |
| EnglishSynonyms: | RARECHEM AL FC 0007 |
| pro_mdlNumber: | MFCD00102861 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | Cc1ccc(cc1)C(=O)C/C(=C\C(=C\2/C(=O)N=C(S2)N3CCOCC3)\c4ccc(cc4)C)/c5ccccc5 |
| InChi: | InChI=1S/C32H30N2O3S/c1-22-8-12-25(13-9-22)28(30-31(36)33-32(38-30)34-16-18-37-19-17-34)20-27(24-6-4-3-5-7-24)21-29(35)26-14-10-23(2)11-15-26/h3-15,20H,16-19,21H2,1-2H3/b27-20+,30-28- |
| InChiKey: | InChIKey=GCIUKNWBGIQOCY-NWDKLRFASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.