* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FD 0024 |
| EnglishSynonyms: | RARECHEM AL FD 0024 |
| pro_mdlNumber: | MFCD00102901 |
| pro_acceptors: | 5 |
| pro_donors: | 0 |
| pro_smile: | Cc1ccc(cc1)n2c(nnn2)/C=C/N3CCCCCC3 |
| InChi: | InChI=1S/C16H21N5/c1-14-6-8-15(9-7-14)21-16(17-18-19-21)10-13-20-11-4-2-3-5-12-20/h6-10,13H,2-5,11-12H2,1H3/b13-10+ |
| InChiKey: | InChIKey=ZPFUFYTZBKSFSP-JLHYYAGUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.