* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL FC 0069 |
EnglishSynonyms: | RARECHEM AL FC 0069 |
pro_mdlNumber: | MFCD00114784 |
pro_acceptors: | 2 |
pro_donors: | 0 |
pro_smile: | c1ccc(cc1)/C(=C/C(=O)c2ccccc2)/CC(=O)c3ccccc3 |
InChi: | InChI=1S/C23H18O2/c24-22(19-12-6-2-7-13-19)16-21(18-10-4-1-5-11-18)17-23(25)20-14-8-3-9-15-20/h1-16H,17H2/b21-16+ |
InChiKey: | InChIKey=DNFKLFZFLOSFFB-LTGZKZEYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.