* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AQ A4 0040 |
EnglishSynonyms: | RARECHEM AQ A4 0040 |
pro_mdlNumber: | MFCD00125581 |
pro_acceptors: | 2 |
pro_donors: | 2 |
pro_smile: | Cc1cccc(c1NC(=S)Nc2c(cccc2C)C)C |
InChi: | InChI=1S/C17H20N2S/c1-11-7-5-8-12(2)15(11)18-17(20)19-16-13(3)9-6-10-14(16)4/h5-10H,1-4H3,(H2,18,19,20) |
InChiKey: | InChIKey=GNNANCVWBKKTDL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.