* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL FF 0009 |
EnglishSynonyms: | RARECHEM AL FF 0009 |
pro_mdlNumber: | MFCD00126605 |
pro_acceptors: | 6 |
pro_donors: | 0 |
pro_smile: | CN(C)/C=C(/c1nnnn1c2ccc(cc2)Br)\C(=O)c3ccccc3 |
InChi: | InChI=1S/C18H16BrN5O/c1-23(2)12-16(17(25)13-6-4-3-5-7-13)18-20-21-22-24(18)15-10-8-14(19)9-11-15/h3-12H,1-2H3/b16-12+ |
InChiKey: | InChIKey=INJGJWLQCJCVRA-FOWTUZBSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.