* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL F1 2025 |
| EnglishSynonyms: | RARECHEM AL F1 2025 |
| pro_mdlNumber: | MFCD00126619 |
| pro_acceptors: | 7 |
| pro_donors: | 1 |
| pro_smile: | COc1ccc(cc1)n2c(nnn2)/C=C\Nc3ccc(cc3)OC(F)(F)F |
| InChi: | InChI=1S/C17H14F3N5O2/c1-26-14-8-4-13(5-9-14)25-16(22-23-24-25)10-11-21-12-2-6-15(7-3-12)27-17(18,19)20/h2-11,21H,1H3/b11-10- |
| InChiKey: | InChIKey=KCOPGVPLJSHLHU-KHPPLWFESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.