* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | LACTIC ACID SODIUM SALT DL-[1-14C] |
| CAS: | 2058-38-0 ;70147-17-0 |
| EnglishSynonyms: | LACTIC ACID SODIUM SALT DL-[1-14C] |
| pro_mdlNumber: | MFCD00133281 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | CC([14C](=O)[O-])O.[Na+] |
| InChi: | InChI=1S/C3H6O3.Na/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1/i3+2; |
| InChiKey: | InChIKey=NGSFWBMYFKHRBD-REVVOINZSA-M |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.