* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | GLY-PRO-GLY-GLY |
CAS: | 13054-03-0 |
EnglishSynonyms: | H-GLY-PRO-GLY-GLY-OH ; GLY-PRO-GLY-GLY |
pro_mdlNumber: | MFCD00133379 |
pro_acceptors: | 9 |
pro_donors: | 4 |
pro_smile: | C1C[C@H](N(C1)C(=O)CN)C(=O)NCC(=O)NCC(=O)O |
InChi: | InChI=1S/C11H18N4O5/c12-4-9(17)15-3-1-2-7(15)11(20)14-5-8(16)13-6-10(18)19/h7H,1-6,12H2,(H,13,16)(H,14,20)(H,18,19)/t7-/m0/s1 |
InChiKey: | InChIKey=PEZMQPADLFXCJJ-ZETCQYMHSA-N |
property |
|
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.