* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-MANNOSE-6-13C |
| EnglishSynonyms: | D-MANNOSE-6-13C |
| pro_mdlNumber: | MFCD00144198 |
| pro_acceptors: | 6 |
| pro_donors: | 5 |
| pro_smile: | [13CH2]([C@H]([C@H]([C@@H]([C@@H](C=O)O)O)O)O)O |
| InChi: | InChI=1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h1,3-6,8-12H,2H2/t3-,4-,5-,6-/m1/s1/i2+1 |
| InChiKey: | InChIKey=GZCGUPFRVQAUEE-LEUDCTHMSA-N |
|
|
| MeltingPoint: | 133 DEG C(LIT) |
| Comments: | MASS SHIFT: M+1 OPTICAL ACTIVITY: [ALPHA]20/D +14.5 DEG, C = 1 IN H2O WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 181.15 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.