* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GLYCOLIC ACID, CALCIUM SALT, [1-14C] |
| EnglishSynonyms: | GLYCOLIC ACID, CALCIUM SALT, [1-14C] |
| pro_mdlNumber: | MFCD00189779 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | C([14C](=O)O[Ca]O[14C](=O)CO)O |
| InChi: | InChI=1S/2C2H4O3.Ca/c2*3-1-2(4)5;/h2*3H,1H2,(H,4,5);/q;;+2/p-2/i2*2+2; |
| InChiKey: | InChIKey=CHRHZFQUDFAQEQ-GINDCNOUSA-L |
* If the product has intellectual property rights, a license granted is must or contact us.