* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | D-LEUCINE, [1-14 C] |
| CAS: | 26011-27-8 |
| EnglishSynonyms: | D-LEUCINE, [1-14 C] ; LEUCINE, D-[1-14C] |
| pro_mdlNumber: | MFCD00189854 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC(C)C[C@H]([14C](=O)O)N |
| InChi: | InChI=1S/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m1/s1/i6+2 |
| InChiKey: | InChIKey=ROHFNLRQFUQHCH-IXMPRESVSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.