* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | OCTANOIC ACID, SODIUM SALT, [1-14C] |
| CAS: | 13095-58-4 |
| EnglishSynonyms: | OCTANOIC ACID, SODIUM SALT, [1-14C] |
| pro_mdlNumber: | MFCD00189934 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CCCCCCC[14C](=O)[O-].[Na+] |
| InChi: | InChI=1S/C8H16O2.Na/c1-2-3-4-5-6-7-8(9)10;/h2-7H2,1H3,(H,9,10);/q;+1/p-1/i8+2; |
| InChiKey: | InChIKey=BYKRNSHANADUFY-WJFUWOTKSA-M |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.