* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | LAURIC ACID-2-13C |
| CAS: | 287100-78-1 |
| EnglishSynonyms: | DODECANOIC-2-13C ACID ; LAURIC ACID-2-13C ; DODECANOIC ACID-2-13C |
| pro_mdlNumber: | MFCD00190308 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCCCCCCCC[13CH2]C(=O)O |
| InChi: | InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14)/i11+1 |
| InChiKey: | InChIKey=POULHZVOKOAJMA-KHWBWMQUSA-N |
|
|
| MeltingPoint: | 44-46 DEG C(LIT) |
| Boiling_Point: | 225 DEG C/100 MMHG(LIT) |
| Comments: | MASS SHIFT: M+1 WGK: 3 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 201.31 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.