* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | VALERIC ACID-5-13C |
EnglishSynonyms: | VALERIC ACID-5-13C ; PENTANOIC ACID-5-13C |
pro_mdlNumber: | MFCD00190344 |
pro_acceptors: | 2 |
pro_donors: | 1 |
pro_smile: | [13CH3]CCCC(=O)O |
InChi: | InChI=1S/C5H10O2/c1-2-3-4-5(6)7/h2-4H2,1H3,(H,6,7)/i1+1 |
InChiKey: | InChIKey=NQPDZGIKBAWPEJ-OUBTZVSYSA-N |
property |
|
MeltingPoint: | -20-(-18) DEG C(LIT) |
Boiling_Point: | 185 DEG C(LIT) |
Density: | DENSITY: 0.948 G/ML AT 25 DEG C |
Comments: | MASS SHIFT: M+1 |
Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 103.12 BY ATOM % CALCULATION |
secure_info |
* If the product has intellectual property rights, a license granted is must or contact us.