* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | DL-PHENYL-D5-ALANINE |
| CAS: | 284664-89-7 |
| EnglishSynonyms: | DL-PHENYL-D5-ALANINE ; DL-PHENYLALANINE (RING-D5) |
| pro_mdlNumber: | MFCD00190497 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | [2H]c1c(c(c(c(c1[2H])[2H])CC(C(=O)O)N)[2H])[2H] |
| InChiKey: | InChIKey=null |
|
|
| MeltingPoint: | 266-267 DEG C (DEC)(LIT) |
| Comments: | MASS SHIFT: M+5 UNSPSC: 12142200 WGK: 3 |
| Information: | ISOTOPIC PURITY: 98 ATOM % D MW: 170.12 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.