* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | LEVOGLUCOSENONE |
| CAS: | 37112-31-5 |
| EnglishSynonyms: | 6,8-DIOXABICYCLO[3.2.1]OCT-2-EN-4-ONE ; (S)-LEVOGLUCOSENONE ; (1S,5R)-6,8-DIOXA-4-OXOBICYCLO[3.2.1]OCT-2-ENE ; (1S,5R)-6,8-DIOXOBICYCLO[3.2.1]OCT-2-EN-4-ONE ; LEVOGLUCOSENONE ; (1S,5R)-6,8-DIOXABICYCLO[3.2.1]OCT-2-EN-4-ONE |
| pro_mdlNumber: | MFCD00191664 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | C1[C@@H]2C=CC(=O)[C@H](O1)O2 |
| InChi: | InChI=1S/C6H6O3/c7-5-2-1-4-3-8-6(5)9-4/h1-2,4,6H,3H2/t4-,6+/m0/s1 |
| InChiKey: | InChIKey=HITOXZPZGPXYHY-UJURSFKZSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.