* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | RARECHEM AL FB 0011 |
EnglishSynonyms: | RARECHEM AL FB 0011 |
pro_mdlNumber: | MFCD00204633 |
pro_acceptors: | 1 |
pro_donors: | 0 |
pro_smile: | C[N+](=C/C=C(/c1ccc(cc1)Br)\Cl)C.[O-]Cl(=O)(=O)=O |
InChi: | InChI=1S/C11H12BrClN.ClHO4/c1-14(2)8-7-11(13)9-3-5-10(12)6-4-9;2-1(3,4)5/h3-8H,1-2H3;(H,2,3,4,5)/q+1;/p-1/b11-7-; |
InChiKey: | InChIKey=YUCVMPTVBOKBCB-AJULUCINSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.