* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9,11-DIOXO-15S-HYDROXY-PROST-13E-EN-1-OIC ACID |
| CAS: | 69413-73-6 |
| EnglishSynonyms: | PROSTAGLANDIN K1 ; 9,11-DIOXO-15S-HYDROXY-PROST-13E-EN-1-OIC ACID |
| pro_mdlNumber: | MFCD00216081 |
| pro_acceptors: | 5 |
| pro_donors: | 2 |
| pro_smile: | CCCCC[C@@H](/C=C/[C@@H]1[C@H](C(=O)CC1=O)CCCCCCC(=O)O)O |
| InChi: | InChI=1S/C20H32O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,21H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+/m0/s1 |
| InChiKey: | InChIKey=KJWZYMMLVHIVSU-IYCNHOCDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.