* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | LIOTHYRONINE I 125 |
| CAS: | 24359-14-6 |
| EnglishSynonyms: | LIOTHYRONINE I 125 |
| pro_mdlNumber: | MFCD00235440 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1cc(c(cc1Oc2c(cc(cc2[125I])C[C@@H](C(=O)O)N)[125I])[125I])O |
| InChi: | InChI=1S/C15H12I3NO4/c16-9-6-8(1-2-13(9)20)23-14-10(17)3-7(4-11(14)18)5-12(19)15(21)22/h1-4,6,12,20H,5,19H2,(H,21,22)/t12-/m0/s1/i16-2,17-2,18-2 |
| InChiKey: | InChIKey=AUYYCJSJGJYCDS-QBYPCAMJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.