* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 7-(1-PHENOXYETHYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
| EnglishSynonyms: | 7-(1-PHENOXYETHYL)[1,2,4]TRIAZOLO[1,5-A]PYRIMIDIN-2-AMINE |
| pro_mdlNumber: | MFCD00243606 |
| pro_acceptors: | 6 |
| pro_donors: | 1 |
| pro_smile: | CC(c1ccnc2n1nc(n2)N)Oc3ccccc3 |
| InChi: | InChI=1S/C13H13N5O/c1-9(19-10-5-3-2-4-6-10)11-7-8-15-13-16-12(14)17-18(11)13/h2-9H,1H3,(H2,14,17) |
| InChiKey: | InChIKey=DSCTYAIKYWSTFP-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 219-221 DEG |
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.