* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | VAT BLACK 27 |
| CAS: | 883833-79-2 |
| EnglishSynonyms: | VAT BLACK 27 |
| pro_mdlNumber: | MFCD00267039 |
| pro_acceptors: | 9 |
| pro_donors: | 3 |
| pro_smile: | c1ccc(cc1)C(=O)Nc2cc3c4c(cc5c(c4NC(=O)c6ccccc6)c(=O)c7ccccc7c5=O)[nH]c3c8c2c(=O)c9ccccc9c8=O |
| InChi: | InChI=1S/C42H23N3O6/c46-37-23-15-7-8-16-24(23)38(47)32-28(37)20-29-31(36(32)45-42(51)22-13-5-2-6-14-22)27-19-30(44-41(50)21-11-3-1-4-12-21)33-34(35(27)43-29)40(49)26-18-10-9-17-25(26)39(33)48/h1-20,43H,(H,44,50)(H,45,51) |
| InChiKey: | InChIKey=ULANYBMMJLLEGN-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.