* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AK PT F113 |
| EnglishSynonyms: | RARECHEM AK PT F113 |
| pro_mdlNumber: | MFCD00270245 |
| pro_acceptors: | 6 |
| pro_donors: | 3 |
| pro_smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](CC(=O)O)CO |
| InChi: | InChI=1S/C19H19NO5/c21-10-12(9-18(22)23)20-19(24)25-11-17-15-7-3-1-5-13(15)14-6-2-4-8-16(14)17/h1-8,12,17,21H,9-11H2,(H,20,24)(H,22,23)/t12-/m0/s1 |
| InChiKey: | InChIKey=AHZFDEXLMKVHIF-LBPRGKRZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.