* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BE 1270 |
| EnglishSynonyms: | RARECHEM AL BE 1270 |
| pro_mdlNumber: | MFCD00427699 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | C(C(=O)O)OCC(C(C(C(F)F)(F)F)(F)F)(F)F |
| InChi: | InChI=1S/C7H6F8O3/c8-4(9)6(12,13)7(14,15)5(10,11)2-18-1-3(16)17/h4H,1-2H2,(H,16,17) |
| InChiKey: | InChIKey=ZIRDUHLMVBDTCW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.