* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM BK HW 0042 |
| EnglishSynonyms: | RARECHEM BK HW 0042 |
| pro_mdlNumber: | MFCD00452728 |
| pro_acceptors: | 5 |
| pro_donors: | 3 |
| pro_smile: | c1cc(c(cc1/C=C/C(=O)O)C(=O)O)O |
| InChi: | InChI=1S/C10H8O5/c11-8-3-1-6(2-4-9(12)13)5-7(8)10(14)15/h1-5,11H,(H,12,13)(H,14,15)/b4-2+ |
| InChiKey: | InChIKey=DUUHXURROBQQSE-DUXPYHPUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.