* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL BK 0044 |
| EnglishSynonyms: | RARECHEM AL BK 0044 |
| pro_mdlNumber: | MFCD00452729 |
| pro_acceptors: | 4 |
| pro_donors: | 2 |
| pro_smile: | c1ccc(c(c1)/C=C/C(=O)O)/C=C/C(=O)O |
| InChi: | InChI=1S/C12H10O4/c13-11(14)7-5-9-3-1-2-4-10(9)6-8-12(15)16/h1-8H,(H,13,14)(H,15,16)/b7-5+,8-6+ |
| InChiKey: | InChIKey=ZFCNOKDRWHSHNR-KQQUZDAGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.