* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | BREVETOXIN 9 |
| CAS: | 155751-73-8 ;142353-09-1 |
| EnglishSynonyms: | BREVETOXIN 9 ; PBTX-9 ; BREVETOXIN PBTX-9 |
| pro_mdlNumber: | MFCD00467023 |
| pro_acceptors: | 13 |
| pro_donors: | 2 |
| pro_smile: | CC1CC2C(CC3(C(O2)CC4C(O3)C(C=CO4)C)C)OC5C1OC6CC7C(CC8C(O7)(C/C=C\C9C(O8)CC1C(O9)CC2C(O1)(C(CC(O2)C(C)CO)O)C)C)(OC6(CC5)C)C |
| InChi: | InChI=1S/C49H74O13/c1-25-12-15-52-35-20-38-47(6,61-44(25)35)22-36-31(56-38)16-26(2)43-29(54-36)11-14-46(5)39(58-43)21-40-48(7,62-46)23-42-45(4,60-40)13-9-10-28-32(57-42)17-34-33(53-28)19-41-49(8,59-34)37(51)18-30(55-41)27(3)24-50/h9-10,12,15,25-44,50-51H,11,13-14,16-24H2,1-8H3/b10-9- |
| InChiKey: | InChIKey=GFTDWUWMLOEFSM-KTKRTIGZSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.