* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM BA KZ 0032 |
| EnglishSynonyms: | RARECHEM BA KZ 0032 |
| pro_mdlNumber: | MFCD00715811 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CCOC(=O)C1=C(Oc2c(ccc3c2nccc3)C1c4ccccc4)N |
| InChi: | InChI=1S/C21H18N2O3/c1-2-25-21(24)17-16(13-7-4-3-5-8-13)15-11-10-14-9-6-12-23-18(14)19(15)26-20(17)22/h3-12,16H,2,22H2,1H3 |
| InChiKey: | InChIKey=GZQIRMBLBVQNGC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.