* If the product has intellectual property rights, a license granted is must or contact us.
basic_info |
|
Product_Name: | IOTYROSINE I 131 |
CAS: | 16624-40-1 |
EnglishSynonyms: | IOTYROSINE I 131 |
pro_mdlNumber: | MFCD00867913 |
pro_acceptors: | 4 |
pro_donors: | 3 |
pro_smile: | c1cc(c(cc1C[C@@H](C(=O)O)N)[131I])O |
InChi: | InChI=1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/t7-/m0/s1/i10+4 |
InChiKey: | InChIKey=UQTZMGFTRHFAAM-VIVGTICWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.