* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | WS 9761 A |
CAS: | 154163-89-0 |
EnglishSynonyms: | WS 9761 A |
pro_mdlNumber: | MFCD00925642 |
pro_acceptors: | 4 |
pro_donors: | 3 |
pro_smile: | Cc1ccc2c(c1O)C(=O)c3c(cc(cc3C2(C)O)O)C |
InChi: | InChI=1S/C17H16O4/c1-8-4-5-11-14(15(8)19)16(20)13-9(2)6-10(18)7-12(13)17(11,3)21/h4-7,18-19,21H,1-3H3 |
InChiKey: | InChIKey=IATHDHXYPWSJAL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.