* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | 9-BROMOACRIDINE |
| CAS: | 4357-57-7 |
| EnglishSynonyms: | 9-BROMOACRIDINE |
| pro_mdlNumber: | MFCD01055528 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | c1ccc2c(c1)c(c3ccccc3n2)Br |
| InChi: | InChI=1S/C13H8BrN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8H |
| InChiKey: | InChIKey=NNTFCRCMYKVMPU-UHFFFAOYSA-N |
|
|
| MeltingPoint: | 115-119 DEG C |
| Comments: | RIDADR: UN 2811 6.1/PG 3 WGK: 3 |
|
|
| secure_symbol: |
GHS05
GHS06
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H301-H315-H318-H335-H413 |
| secure_cautionary_stmt: | P261-P280-P301 + P310-P305 + P351 + P338 |
| secure_damage_code: | T |
| secure_risk_disclosure_stmt: | R:25-36/37-41 |
| secure_security_stmt: | S:26-39-45 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.