* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | OCTANOIC ACID-1,2-13C2 |
| CAS: | 202114-57-6 |
| EnglishSynonyms: | OCTANOIC ACID-1,2-13C2 ; CAPRYLIC ACID-1,2-13C2 |
| pro_mdlNumber: | MFCD01073419 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | CCCCCC[13CH2][13C](=O)O |
| InChi: | InChI=1S/C8H16O2/c1-2-3-4-5-6-7-8(9)10/h2-7H2,1H3,(H,9,10)/i7+1,8+1 |
| InChiKey: | InChIKey=WWZKQHOCKIZLMA-BFGUONQLSA-N |
|
|
| MeltingPoint: | 16 DEG C(LIT) |
| Boiling_Point: | 237 DEG C(LIT) |
| Density: | DENSITY: 0.922 G/ML AT 25 DEG C |
| PhysicalProperty: | FLASHPOINT: 113 DEG C FLASHPOINT: 235.4 DEG F |
| Comments: | MASS SHIFT: M+2 RIDADR: UN 3265 8/PG 3 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % 13C MW: 146.20 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.