* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 |
| CAS: | 84272-90-2 |
| EnglishSynonyms: | ETHYL-1,1-D2 BENZENE-D5 ; ETHYL-ALPHA,ALPHA-D2-BENZENE-D5 |
| pro_mdlNumber: | MFCD01075475 |
| pro_acceptors: | 0 |
| pro_donors: | 0 |
| pro_smile: | [2H]c1c(c(c(c(c1[2H])[2H])C([2H])([2H])C)[2H])[2H] |
| InChiKey: | InChIKey=null |
|
|
| Boiling_Point: | 136 DEG C(LIT) |
| Density: | DENSITY: 0.923 G/ML AT 25 DEG C |
| PhysicalProperty: | FLASHPOINT: 22 DEG C FLASHPOINT: 71.6 DEG F |
| Comments: | MASS SHIFT: M+7 RIDADR: UN 1175 3/PG 2 WGK: 1 |
| Information: | ISOTOPIC PURITY: 99 ATOM % D MW: 113.14 BY ATOM % CALCULATION |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.