* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | IODOACETAMIDE-15N |
| CAS: | 287476-20-4 |
| EnglishSynonyms: | IODOACETAMIDE-15N |
| pro_mdlNumber: | MFCD01075619 |
| pro_acceptors: | 2 |
| pro_donors: | 1 |
| pro_smile: | C(C(=O)[15NH2])I |
| InChi: | InChI=1S/C2H4INO/c3-1-2(4)5/h1H2,(H2,4,5)/i4+1 |
| InChiKey: | InChIKey=PGLTVOMIXTUURA-AZXPZELESA-N |
|
|
| MeltingPoint: | 92-95 DEG C(LIT) |
| Comments: | MASS SHIFT: M+1 RIDADR: UN 2811 6.1/PG 3 WGK: 3 |
| Information: | ISOTOPIC PURITY: 98 ATOM % 15N MW: 185.94 BY ATOM % CALCULATION |
|
|
| secure_symbol: |
GHS06
GHS08
|
| secure_signal_word: | Danger |
| secure_risk_stmt: | H301-H317-H334 |
| secure_cautionary_stmt: | P261-P280-P301 + P310-P342 + P311 |
| secure_damage_code: | T |
| secure_risk_disclosure_stmt: | R:25-42/43 |
| secure_security_stmt: | S:22-36/37-45 |
| secure_wgk_germany: | 3 |
* If the product has intellectual property rights, a license granted is must or contact us.