* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | OROTIC ACID METHYL ESTER[2-14C] |
| EnglishSynonyms: | OROTIC ACID METHYL ESTER[2-14C] |
| pro_mdlNumber: | MFCD01075902 |
| pro_acceptors: | 6 |
| pro_donors: | 2 |
| pro_smile: | COC(=O)c1cc(=O)[nH][14c](=O)[nH]1 |
| InChi: | InChI=1S/C6H6N2O4/c1-12-5(10)3-2-4(9)8-6(11)7-3/h2H,1H3,(H2,7,8,9,11)/i6+2 |
| InChiKey: | InChIKey=UUTDWTOZAWFKFW-ZQBYOMGUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.