* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM GT HW 1968 |
| EnglishSynonyms: | RARECHEM GT HW 1968 |
| pro_mdlNumber: | MFCD01707969 |
| pro_acceptors: | 1 |
| pro_donors: | 0 |
| pro_smile: | CC(Cc1cccc(c1)C(F)(F)F)N(C)C |
| InChi: | InChI=1S/C12H16F3N/c1-9(16(2)3)7-10-5-4-6-11(8-10)12(13,14)15/h4-6,8-9H,7H2,1-3H3 |
| InChiKey: | InChIKey=WLLQUCUAFUGKTR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.