* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AN KC 0523 |
| EnglishSynonyms: | RARECHEM AN KC 0523 |
| pro_mdlNumber: | MFCD01721788 |
| pro_acceptors: | 3 |
| pro_donors: | 2 |
| pro_smile: | CC(Cc1c[nH]cn1)N |
| InChi: | InChI=1S/C6H11N3/c1-5(7)2-6-3-8-4-9-6/h3-5H,2,7H2,1H3,(H,8,9) |
| InChiKey: | InChIKey=XNQIOISZPFVUFG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.