* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AM UG B256 |
| EnglishSynonyms: | RARECHEM AM UG B256 |
| pro_mdlNumber: | MFCD01723154 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CC(C)CC(=O)/C=C/c1cc(c(c(c1)OC)OC)OC |
| InChi: | InChI=1S/C16H22O4/c1-11(2)8-13(17)7-6-12-9-14(18-3)16(20-5)15(10-12)19-4/h6-7,9-11H,8H2,1-5H3/b7-6+ |
| InChiKey: | InChIKey=FERGHQVZNVYALP-VOTSOKGWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.