* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product_Name: | GLUTARAMIC ACID, 4-AMINO-N-(1-(3-INDOLYL)-2-PROPYL)-, (+)-(L)- |
CAS: | 12672-63-8 |
EnglishSynonyms: | GLUTARAMIC ACID, 4-AMINO-N-(1-(3-INDOLYL)-2-PROPYL)-, (+)-(L)- |
pro_mdlNumber: | MFCD01725160 |
pro_acceptors: | 6 |
pro_donors: | 4 |
pro_smile: | C[C@@H](CNC(=O)[C@H](CCC(=O)O)N)c1c[nH]c2c1cccc2 |
InChi: | InChI=1S/C16H21N3O3/c1-10(8-19-16(22)13(17)6-7-15(20)21)12-9-18-14-5-3-2-4-11(12)14/h2-5,9-10,13,18H,6-8,17H2,1H3,(H,19,22)(H,20,21)/t10-,13-/m0/s1 |
InChiKey: | InChIKey=ZAQWNEGZKDTUOA-GWCFXTLKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.