* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | GLUTAMINE, N-(2-(5-METHOXY-3-INDOLYL)ETHYL)-, L- |
| CAS: | 5598-30-1 |
| EnglishSynonyms: | GLUTAMINE, N-(2-(5-METHOXY-3-INDOLYL)ETHYL)-, L- |
| pro_mdlNumber: | MFCD01725185 |
| pro_acceptors: | 7 |
| pro_donors: | 4 |
| pro_smile: | COc1ccc2c(c1)c(c[nH]2)CCNC(=O)CC[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C16H21N3O4/c1-23-11-2-4-14-12(8-11)10(9-19-14)6-7-18-15(20)5-3-13(17)16(21)22/h2,4,8-9,13,19H,3,5-7,17H2,1H3,(H,18,20)(H,21,22)/t13-/m0/s1 |
| InChiKey: | InChIKey=CISGHTVWEIDRON-ZDUSSCGKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.