* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | FURO(3,2-B)FURAN, D-GLUCITOL DERIV |
| CAS: | 135304-12-0 |
| EnglishSynonyms: | FURO(3,2-B)FURAN, D-GLUCITOL DERIV |
| pro_mdlNumber: | MFCD01725426 |
| pro_acceptors: | 9 |
| pro_donors: | 0 |
| pro_smile: | c1c(cncc1F)C(=O)O[C@H]2CO[C@H]3[C@@H]2OC[C@H]3O[N+](=O)[O-] |
| InChi: | InChI=1S/C12H11FN2O7/c13-7-1-6(2-14-3-7)12(16)21-8-4-19-11-9(22-15(17)18)5-20-10(8)11/h1-3,8-11H,4-5H2/t8-,9+,10+,11+/m0/s1 |
| InChiKey: | InChIKey=UBZJTFBHSHSATM-LNFKQOIKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.