* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | ETHANONE, 1-(5-AMINO-1,2,4-OXADIAZOL-3-YL)- |
| CAS: | 42837-62-7 |
| EnglishSynonyms: | 1-(3-AMINO-1,2,4-OXADIAZOL-5-YL)ETHAN-1-ONE ; ETHANONE, 1-(5-AMINO-1,2,4-OXADIAZOL-3-YL)- ; 1-(5-AMINO-1,2,4-OXADIAZOL-3-YL)-ETHANONE |
| pro_mdlNumber: | MFCD01727660 |
| pro_acceptors: | 5 |
| pro_donors: | 1 |
| pro_smile: | CC(=O)c1nc(no1)N |
| InChi: | InChI=1S/C4H5N3O2/c1-2(8)3-6-4(5)7-9-3/h1H3,(H2,5,7) |
| InChiKey: | InChIKey=PTVKXUWEAQSUCM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.