* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FE 0071 |
| EnglishSynonyms: | RARECHEM AL FE 0071 |
| pro_mdlNumber: | MFCD01822896 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | c1cc(ccc1/C(=C/C=C(C#N)C#N)/N2CCOCC2)Br |
| InChi: | InChI=1S/C16H14BrN3O/c17-15-4-2-14(3-5-15)16(6-1-13(11-18)12-19)20-7-9-21-10-8-20/h1-6H,7-10H2/b16-6- |
| InChiKey: | InChIKey=MUTITDCVJRHIID-SOFYXZRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.