* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AQ TC 1025 |
| EnglishSynonyms: | RARECHEM AQ TC 1025 |
| pro_mdlNumber: | MFCD01823052 |
| pro_acceptors: | 3 |
| pro_donors: | 1 |
| pro_smile: | COC(=O)N[C@]12C[C@@H]3C[C@H](C1)C[C@@H](C3)C2 |
| InChi: | InChI=1S/C12H19NO2/c1-15-11(14)13-12-5-8-2-9(6-12)4-10(3-8)7-12/h8-10H,2-7H2,1H3,(H,13,14)/t8-,9+,10-,12- |
| InChiKey: | InChIKey=KVYWCOQWNCLBCI-GOCCLTDMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.