* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FE 0073 |
| EnglishSynonyms: | RARECHEM AL FE 0073 |
| pro_mdlNumber: | MFCD01850854 |
| pro_acceptors: | 3 |
| pro_donors: | 0 |
| pro_smile: | CS/C(=N\C#N)/S/C=C/C(=O)c1cccc2c1cccc2 |
| InChi: | InChI=1S/C16H12N2OS2/c1-20-16(18-11-17)21-10-9-15(19)14-8-4-6-12-5-2-3-7-13(12)14/h2-10H,1H3/b10-9+,18-16+ |
| InChiKey: | InChIKey=QLWCLXSQTYEDPY-XYIBPJHQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.