* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | RARECHEM AL FM 0016 |
| EnglishSynonyms: | RARECHEM AL FM 0016 |
| pro_mdlNumber: | MFCD01850861 |
| pro_acceptors: | 4 |
| pro_donors: | 0 |
| pro_smile: | CN(C)C(/C=C(/c1ccc(cc1)Br)\Cl)P(=O)(OC)OC.OCl(=O)(=O)=O |
| InChi: | InChI=1S/C13H18BrClNO3P.ClHO4/c1-16(2)13(20(17,18-3)19-4)9-12(15)10-5-7-11(14)8-6-10;2-1(3,4)5/h5-9,13H,1-4H3;(H,2,3,4,5)/b12-9-; |
| InChiKey: | InChIKey=RQEZYSQUYIQBAI-MWMYENNMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.